C15H23NO — CID 116817401
5-[(2,5-dimethylphenyl)methyl]-3,3-dimethylmorpholine (PubChem CID 116817401) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)methyl]-3,3-dimethylmorpholine.
| Compound Name | 5-[(2,5-dimethylphenyl)methyl]-3,3-dimethylmorpholine |
|---|---|
| PubChem CID | 116817401 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)methyl]-3,3-dimethylmorpholine |
| SMILES | Cc1ccc(C)c(CC2COCC(C)(C)N2)c1 |
| InChI | InChI=1S/C15H23NO/c1-11-5-6-12(2)13(7-11)8-14-9-17-10-15(3,4)16-14/h5-7,14,16H,8-10H2,1-4H3 |
| InChIKey | CQCLJHNBKKDPIK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |