C12H16O5S — CID 134537896
2-[[(2S)-1,4-dioxan-2-yl]methyl]-4-methylbenzenesulfonic acid (PubChem CID 134537896) has the molecular formula C12H16O5S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[[(2S)-1,4-dioxan-2-yl]methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[[(2S)-1,4-dioxan-2-yl]methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 134537896 |
| Molecular Formula | C12H16O5S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[[(2S)-1,4-dioxan-2-yl]methyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C[C@H]2COCCO2)c1 |
| InChI | InChI=1S/C12H16O5S/c1-9-2-3-12(18(13,14)15)10(6-9)7-11-8-16-4-5-17-11/h2-3,6,11H,4-5,7-8H2,1H3,(H,13,14,15)/t11-/m0/s1 |
| InChIKey | NKNWQGMEWBCBTG-NSHDSACASA-N |
| XLogP | 1.20 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|