C13H16Br2O3S — CID 88700265
2-[(2,2-dibromo-3,3-dimethylcyclopropyl)methyl]-4-methylbenzenesulfonic acid (PubChem CID 88700265) has the molecular formula C13H16Br2O3S and a molecular weight of 412.14 g/mol. Its IUPAC name is 2-[(2,2-dibromo-3,3-dimethylcyclopropyl)methyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(2,2-dibromo-3,3-dimethylcyclopropyl)methyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 88700265 |
| Molecular Formula | C13H16Br2O3S |
| Molecular Weight | 412.14 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | 2-[(2,2-dibromo-3,3-dimethylcyclopropyl)methyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CC2C(C)(C)C2(Br)Br)c1 |
| InChI | InChI=1S/C13H16Br2O3S/c1-8-4-5-10(19(16,17)18)9(6-8)7-11-12(2,3)13(11,14)15/h4-6,11H,7H2,1-3H3,(H,16,17,18) |
| InChIKey | HINCMOYGEOAYKG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|