C16H18O6S2 — CID 175863440
4-methyl-2-[1,1,2,2-tetradeuterio-2-(5-methyl-2-sulfophenyl)ethyl]benzenesulfonic acid (PubChem CID 175863440) has the molecular formula C16H18O6S2 and a molecular weight of 374.47 g/mol. Its IUPAC name is 4-methyl-2-[1,1,2,2-tetradeuterio-2-(5-methyl-2-sulfophenyl)ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[1,1,2,2-tetradeuterio-2-(5-methyl-2-sulfophenyl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175863440 |
| Molecular Formula | C16H18O6S2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 4-methyl-2-[1,1,2,2-tetradeuterio-2-(5-methyl-2-sulfophenyl)ethyl]benzenesulfonic acid |
| SMILES | [2H]C([2H])(c1cc(C)ccc1S(=O)(=O)O)C([2H])([2H])c1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H18O6S2/c1-11-3-7-15(23(17,18)19)13(9-11)5-6-14-10-12(2)4-8-16(14)24(20,21)22/h3-4,7-10H,5-6H2,1-2H3,(H,17,18,19)(H,20,21,22)/i5D2,6D2 |
| InChIKey | NOSFOHBDBNIIJQ-NZLXMSDQSA-N |
| XLogP | 2.58 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|