C15H24O3S — CID 20534379
4-methyl-2-(5-methylheptyl)benzenesulfonic acid (PubChem CID 20534379) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is 4-methyl-2-(5-methylheptyl)benzenesulfonic acid.
| Compound Name | 4-methyl-2-(5-methylheptyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 20534379 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-methyl-2-(5-methylheptyl)benzenesulfonic acid |
| SMILES | CCC(C)CCCCc1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C15H24O3S/c1-4-12(2)7-5-6-8-14-11-13(3)9-10-15(14)19(16,17)18/h9-12H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | GUYRAMYDBZUFSN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|