C18H22O7S2 — CID 118646437
2-[(3S)-3-hydroxy-4-(5-methyl-2-sulfophenyl)butyl]-4-methylbenzenesulfonic acid (PubChem CID 118646437) has the molecular formula C18H22O7S2 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxy-4-(5-methyl-2-sulfophenyl)butyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[(3S)-3-hydroxy-4-(5-methyl-2-sulfophenyl)butyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118646437 |
| Molecular Formula | C18H22O7S2 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-[(3S)-3-hydroxy-4-(5-methyl-2-sulfophenyl)butyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CC[C@H](O)Cc2cc(C)ccc2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H22O7S2/c1-12-3-7-17(26(20,21)22)14(9-12)5-6-16(19)11-15-10-13(2)4-8-18(15)27(23,24)25/h3-4,7-10,16,19H,5-6,11H2,1-2H3,(H,20,21,22)(H,23,24,25)/t16-/m0/s1 |
| InChIKey | FJVPJEKQSAIIBX-INIZCTEOSA-N |
| XLogP | 2.33 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|