C20H26O6S2 — CID 87104510
4-methyl-2-[2-(5-methyl-2-sulfophenyl)hexyl]benzenesulfonic acid (PubChem CID 87104510) has the molecular formula C20H26O6S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-methyl-2-[2-(5-methyl-2-sulfophenyl)hexyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-(5-methyl-2-sulfophenyl)hexyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87104510 |
| Molecular Formula | C20H26O6S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 4-methyl-2-[2-(5-methyl-2-sulfophenyl)hexyl]benzenesulfonic acid |
| SMILES | CCCCC(Cc1cc(C)ccc1S(=O)(=O)O)c1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C20H26O6S2/c1-4-5-6-16(18-12-15(3)8-10-20(18)28(24,25)26)13-17-11-14(2)7-9-19(17)27(21,22)23/h7-12,16H,4-6,13H2,1-3H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | HVUPMQDMIPQANB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|