C26H30O6S2 — CID 129185635
4-methyl-2-[3-[3-[3-(5-methyl-2-sulfophenyl)propyl]phenyl]propyl]benzenesulfonic acid (PubChem CID 129185635) has the molecular formula C26H30O6S2 and a molecular weight of 502.65 g/mol. Its IUPAC name is 4-methyl-2-[3-[3-[3-(5-methyl-2-sulfophenyl)propyl]phenyl]propyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[3-[3-[3-(5-methyl-2-sulfophenyl)propyl]phenyl]propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 129185635 |
| Molecular Formula | C26H30O6S2 |
| Molecular Weight | 502.65 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | 4-methyl-2-[3-[3-[3-(5-methyl-2-sulfophenyl)propyl]phenyl]propyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCCc2cccc(CCCc3cc(C)ccc3S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C26H30O6S2/c1-19-12-14-25(33(27,28)29)23(16-19)10-4-8-21-6-3-7-22(18-21)9-5-11-24-17-20(2)13-15-26(24)34(30,31)32/h3,6-7,12-18H,4-5,8-11H2,1-2H3,(H,27,28,29)(H,30,31,32) |
| InChIKey | ZYLFAWYEIMILAD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|