C16H15F3O3S — CID 54384107
4-methyl-2-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonic acid (PubChem CID 54384107) has the molecular formula C16H15F3O3S and a molecular weight of 344.35 g/mol. Its IUPAC name is 4-methyl-2-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54384107 |
| Molecular Formula | C16H15F3O3S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-methyl-2-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3O3S/c1-11-5-8-15(23(20,21)22)13(9-11)7-6-12-3-2-4-14(10-12)16(17,18)19/h2-5,8-10H,6-7H2,1H3,(H,20,21,22) |
| InChIKey | VCAGIHURCKEPCQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|