C16H18O4S — CID 87200037
4-methyl-2-(2-phenylmethoxyethyl)benzenesulfonic acid (PubChem CID 87200037) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is 4-methyl-2-(2-phenylmethoxyethyl)benzenesulfonic acid.
| Compound Name | 4-methyl-2-(2-phenylmethoxyethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 87200037 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-methyl-2-(2-phenylmethoxyethyl)benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCc2ccccc2)c1 |
| InChI | InChI=1S/C16H18O4S/c1-13-7-8-16(21(17,18)19)15(11-13)9-10-20-12-14-5-3-2-4-6-14/h2-8,11H,9-10,12H2,1H3,(H,17,18,19) |
| InChIKey | IXXUHFFWHWVWDP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|