C20H33NO9S — CID 175335450
2-[2-[2-[2-[2-(2,2-dimethylpropanoyloxyamino)oxyethoxy]ethoxy]ethoxy]ethyl]-4-methylbenzenesulfonic acid (PubChem CID 175335450) has the molecular formula C20H33NO9S and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2,2-dimethylpropanoyloxyamino)oxyethoxy]ethoxy]ethoxy]ethyl]-4-methylbenzenesulfonic acid.
| Compound Name | 2-[2-[2-[2-[2-(2,2-dimethylpropanoyloxyamino)oxyethoxy]ethoxy]ethoxy]ethyl]-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 175335450 |
| Molecular Formula | C20H33NO9S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[2-[2-[2-[2-(2,2-dimethylpropanoyloxyamino)oxyethoxy]ethoxy]ethoxy]ethyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(CCOCCOCCOCCONOC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H33NO9S/c1-16-5-6-18(31(23,24)25)17(15-16)7-8-26-9-10-27-11-12-28-13-14-29-21-30-19(22)20(2,3)4/h5-6,15,21H,7-14H2,1-4H3,(H,23,24,25) |
| InChIKey | NNQFSPAVDWTLKE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|