C14H20O5S — CID 56639315
2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonic acid (PubChem CID 56639315) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonic acid.
| Compound Name | 2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 56639315 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 2-(3-ethoxy-2,2-dimethyl-3-oxopropyl)-4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)C(C)(C)Cc1cc(C)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C14H20O5S/c1-5-19-13(15)14(3,4)9-11-8-10(2)6-7-12(11)20(16,17)18/h6-8H,5,9H2,1-4H3,(H,16,17,18) |
| InChIKey | SBMVTHZDXQITDL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|