C14H20O2 — CID 116927517
methyl 3-(2,5-dimethylphenyl)-2,2-dimethylpropanoate (PubChem CID 116927517) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is methyl 3-(2,5-dimethylphenyl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(2,5-dimethylphenyl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 116927517 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | methyl 3-(2,5-dimethylphenyl)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1cc(C)ccc1C |
| InChI | InChI=1S/C14H20O2/c1-10-6-7-11(2)12(8-10)9-14(3,4)13(15)16-5/h6-8H,9H2,1-5H3 |
| InChIKey | WCFIPFDKGISKMZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |