C16H23BrO3 — CID 59197717
methyl 3-[4-(2-bromoethoxy)-2,5-dimethylphenyl]-2,2-dimethylpropanoate (PubChem CID 59197717) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is methyl 3-[4-(2-bromoethoxy)-2,5-dimethylphenyl]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[4-(2-bromoethoxy)-2,5-dimethylphenyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59197717 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | methyl 3-[4-(2-bromoethoxy)-2,5-dimethylphenyl]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)Cc1cc(C)c(OCCBr)cc1C |
| InChI | InChI=1S/C16H23BrO3/c1-11-9-14(20-7-6-17)12(2)8-13(11)10-16(3,4)15(18)19-5/h8-9H,6-7,10H2,1-5H3 |
| InChIKey | XENKTMGKLXLHLC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|