C14H17BrO4 — CID 112752353
methyl 4-(5-bromo-2-methylphenoxy)-2,2-dimethyl-3-oxobutanoate (PubChem CID 112752353) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is methyl 4-(5-bromo-2-methylphenoxy)-2,2-dimethyl-3-oxobutanoate.
| Compound Name | methyl 4-(5-bromo-2-methylphenoxy)-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 112752353 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | methyl 4-(5-bromo-2-methylphenoxy)-2,2-dimethyl-3-oxobutanoate |
| SMILES | COC(=O)C(C)(C)C(=O)COc1cc(Br)ccc1C |
| InChI | InChI=1S/C14H17BrO4/c1-9-5-6-10(15)7-11(9)19-8-12(16)14(2,3)13(17)18-4/h5-7H,8H2,1-4H3 |
| InChIKey | BAYXUMHOVZKUIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|