C15H20O4 — CID 112752330
methyl 4-(2,6-dimethylphenoxy)-2,2-dimethyl-3-oxobutanoate (PubChem CID 112752330) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is methyl 4-(2,6-dimethylphenoxy)-2,2-dimethyl-3-oxobutanoate.
| Compound Name | methyl 4-(2,6-dimethylphenoxy)-2,2-dimethyl-3-oxobutanoate |
|---|---|
| PubChem CID | 112752330 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | methyl 4-(2,6-dimethylphenoxy)-2,2-dimethyl-3-oxobutanoate |
| SMILES | COC(=O)C(C)(C)C(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C15H20O4/c1-10-7-6-8-11(2)13(10)19-9-12(16)15(3,4)14(17)18-5/h6-8H,9H2,1-5H3 |
| InChIKey | ZHTCUTVZAVGOHP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|