C15H21NO4 — CID 67984261
methyl 2-(2,6-dimethylanilino)-4-methoxy-2-methyl-3-oxobutanoate (PubChem CID 67984261) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 2-(2,6-dimethylanilino)-4-methoxy-2-methyl-3-oxobutanoate.
| Compound Name | methyl 2-(2,6-dimethylanilino)-4-methoxy-2-methyl-3-oxobutanoate |
|---|---|
| PubChem CID | 67984261 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl 2-(2,6-dimethylanilino)-4-methoxy-2-methyl-3-oxobutanoate |
| SMILES | COCC(=O)C(C)(Nc1c(C)cccc1C)C(=O)OC |
| InChI | InChI=1S/C15H21NO4/c1-10-7-6-8-11(2)13(10)16-15(3,14(18)20-5)12(17)9-19-4/h6-8,16H,9H2,1-5H3 |
| InChIKey | PBYHTLIYRTYOAB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|