C16H24O4 — CID 86746388
methyl 5-(4-hydroxy-2,5-dimethylphenoxy)-2,2-dimethylpentanoate (PubChem CID 86746388) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 5-(4-hydroxy-2,5-dimethylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | methyl 5-(4-hydroxy-2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 86746388 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 5-(4-hydroxy-2,5-dimethylphenoxy)-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1cc(C)c(O)cc1C |
| InChI | InChI=1S/C16H24O4/c1-11-10-14(12(2)9-13(11)17)20-8-6-7-16(3,4)15(18)19-5/h9-10,17H,6-8H2,1-5H3 |
| InChIKey | NKGVWKWKRCYMGU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|