C23H28F2N2O4 — CID 86746453
methyl 5-[4-[(2,4-difluorophenyl)carbamoylamino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate (PubChem CID 86746453) has the molecular formula C23H28F2N2O4 and a molecular weight of 434.48 g/mol. Its IUPAC name is methyl 5-[4-[(2,4-difluorophenyl)carbamoylamino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate.
| Compound Name | methyl 5-[4-[(2,4-difluorophenyl)carbamoylamino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 86746453 |
| Molecular Formula | C23H28F2N2O4 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | methyl 5-[4-[(2,4-difluorophenyl)carbamoylamino]-2,5-dimethylphenoxy]-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1cc(C)c(NC(=O)Nc2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C23H28F2N2O4/c1-14-12-20(31-10-6-9-23(3,4)21(28)30-5)15(2)11-19(14)27-22(29)26-18-8-7-16(24)13-17(18)25/h7-8,11-13H,6,9-10H2,1-5H3,(H2,26,27,29) |
| InChIKey | UQKMTKZUDGWJPX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|