C24H32O3 — CID 59138116
methyl 2,2-dimethyl-8-[2-(4-methylphenyl)phenoxy]octanoate (PubChem CID 59138116) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 2,2-dimethyl-8-[2-(4-methylphenyl)phenoxy]octanoate.
| Compound Name | methyl 2,2-dimethyl-8-[2-(4-methylphenyl)phenoxy]octanoate |
|---|---|
| PubChem CID | 59138116 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | methyl 2,2-dimethyl-8-[2-(4-methylphenyl)phenoxy]octanoate |
| SMILES | COC(=O)C(C)(C)CCCCCCOc1ccccc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H32O3/c1-19-13-15-20(16-14-19)21-11-7-8-12-22(21)27-18-10-6-5-9-17-24(2,3)23(25)26-4/h7-8,11-16H,5-6,9-10,17-18H2,1-4H3 |
| InChIKey | CXTCDMCFOLSIEB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|