C19H29BrO4 — CID 14349184
methyl 5-[4-(5-bromopentoxy)phenoxy]-2,2-dimethylpentanoate (PubChem CID 14349184) has the molecular formula C19H29BrO4 and a molecular weight of 401.34 g/mol. Its IUPAC name is methyl 5-[4-(5-bromopentoxy)phenoxy]-2,2-dimethylpentanoate.
| Compound Name | methyl 5-[4-(5-bromopentoxy)phenoxy]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 14349184 |
| Molecular Formula | C19H29BrO4 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | methyl 5-[4-(5-bromopentoxy)phenoxy]-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1ccc(OCCCCCBr)cc1 |
| InChI | InChI=1S/C19H29BrO4/c1-19(2,18(21)22-3)12-7-15-24-17-10-8-16(9-11-17)23-14-6-4-5-13-20/h8-11H,4-7,12-15H2,1-3H3 |
| InChIKey | ONZDGCHWIJYOOV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|