C17H23BrO5 — CID 167279907
dimethyl 4-(7-bromoheptoxy)benzene-1,2-dicarboxylate (PubChem CID 167279907) has the molecular formula C17H23BrO5 and a molecular weight of 387.27 g/mol. Its IUPAC name is dimethyl 4-(7-bromoheptoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(7-bromoheptoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 167279907 |
| Molecular Formula | C17H23BrO5 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | dimethyl 4-(7-bromoheptoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCCCCCCCBr)cc1C(=O)OC |
| InChI | InChI=1S/C17H23BrO5/c1-21-16(19)14-9-8-13(12-15(14)17(20)22-2)23-11-7-5-3-4-6-10-18/h8-9,12H,3-7,10-11H2,1-2H3 |
| InChIKey | BFJDZXNAUXYRRM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|