C12H12O6 — CID 54350444
dimethyl 4-(2-oxoethoxy)benzene-1,2-dicarboxylate (PubChem CID 54350444) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is dimethyl 4-(2-oxoethoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(2-oxoethoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54350444 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | dimethyl 4-(2-oxoethoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCC=O)cc1C(=O)OC |
| InChI | InChI=1S/C12H12O6/c1-16-11(14)9-4-3-8(18-6-5-13)7-10(9)12(15)17-2/h3-5,7H,6H2,1-2H3 |
| InChIKey | RLHVFZYQCMCUDD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|