C15H12F8O5 — CID 170857446
dimethyl 4-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarboxylate (PubChem CID 170857446) has the molecular formula C15H12F8O5 and a molecular weight of 424.24 g/mol. Its IUPAC name is dimethyl 4-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 170857446 |
| Molecular Formula | C15H12F8O5 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | dimethyl 4-(2,2,3,3,4,4,5,5-octafluoropentoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C15H12F8O5/c1-26-10(24)8-4-3-7(5-9(8)11(25)27-2)28-6-13(18,19)15(22,23)14(20,21)12(16)17/h3-5,12H,6H2,1-2H3 |
| InChIKey | XNICEPCISYNUBM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|