C15H18O5 — CID 69421609
dimethyl 4-(3-methylbut-2-enoxy)benzene-1,2-dicarboxylate (PubChem CID 69421609) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is dimethyl 4-(3-methylbut-2-enoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(3-methylbut-2-enoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 69421609 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | dimethyl 4-(3-methylbut-2-enoxy)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(OCC=C(C)C)cc1C(=O)OC |
| InChI | InChI=1S/C15H18O5/c1-10(2)7-8-20-11-5-6-12(14(16)18-3)13(9-11)15(17)19-4/h5-7,9H,8H2,1-4H3 |
| InChIKey | CVMORAQWIKTAAX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|