C29H38O13 — CID 159988361
dimethyl 4-[2-(2-hydroxyethoxy)ethoxy]benzene-1,2-dicarboxylate;dimethyl 4-(2-propoxyethoxy)benzene-1,2-dicarboxylate (PubChem CID 159988361) has the molecular formula C29H38O13 and a molecular weight of 594.61 g/mol. Its IUPAC name is dimethyl 4-[2-(2-hydroxyethoxy)ethoxy]benzene-1,2-dicarboxylate;dimethyl 4-(2-propoxyethoxy)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[2-(2-hydroxyethoxy)ethoxy]benzene-1,2-dicarboxylate;dimethyl 4-(2-propoxyethoxy)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 159988361 |
| Molecular Formula | C29H38O13 |
| Molecular Weight | 594.61 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | dimethyl 4-[2-(2-hydroxyethoxy)ethoxy]benzene-1,2-dicarboxylate;dimethyl 4-(2-propoxyethoxy)benzene-1,2-dicarboxylate |
| SMILES | CCCOCCOc1ccc(C(=O)OC)c(C(=O)OC)c1.COC(=O)c1ccc(OCCOCCO)cc1C(=O)OC |
| InChI | InChI=1S/C15H20O6.C14H18O7/c1-4-7-20-8-9-21-11-5-6-12(14(16)18-2)13(10-11)15(17)19-3;1-18-13(16)11-4-3-10(9-12(11)14(17)19-2)21-8-7-20-6-5-15/h5-6,10H,4,7-9H2,1-3H3;3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | OGPUZSPVQKXMKW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 162.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|