C19H18O4 — CID 15532242
methyl 2-hydroxy-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]benzoate (PubChem CID 15532242) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]benzoate.
| Compound Name | methyl 2-hydroxy-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]benzoate |
|---|---|
| PubChem CID | 15532242 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl 2-hydroxy-5-[(2E,4E)-5-phenylpenta-2,4-dienoxy]benzoate |
| SMILES | COC(=O)c1cc(OC/C=C/C=C/c2ccccc2)ccc1O |
| InChI | InChI=1S/C19H18O4/c1-22-19(21)17-14-16(11-12-18(17)20)23-13-7-3-6-10-15-8-4-2-5-9-15/h2-12,14,20H,13H2,1H3/b7-3+,10-6+ |
| InChIKey | ZHGFJAXUKMOIIH-ASVGJQBISA-N |
| XLogP | 3.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|