C18H19NO4 — CID 174690437
2-hydroxy-4-(2-methoxyethoxy)-N-(2-phenylethenyl)benzamide (PubChem CID 174690437) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-hydroxy-4-(2-methoxyethoxy)-N-(2-phenylethenyl)benzamide.
| Compound Name | 2-hydroxy-4-(2-methoxyethoxy)-N-(2-phenylethenyl)benzamide |
|---|---|
| PubChem CID | 174690437 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-hydroxy-4-(2-methoxyethoxy)-N-(2-phenylethenyl)benzamide |
| SMILES | COCCOc1ccc(C(=O)NC=Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C18H19NO4/c1-22-11-12-23-15-7-8-16(17(20)13-15)18(21)19-10-9-14-5-3-2-4-6-14/h2-10,13,20H,11-12H2,1H3,(H,19,21) |
| InChIKey | IFVDLAWFAMROKY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|