C23H29NO8 — CID 66993266
benzyl 3-hydroxy-2-[[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]benzoyl]amino]-2-methylpropanoate (PubChem CID 66993266) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is benzyl 3-hydroxy-2-[[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]benzoyl]amino]-2-methylpropanoate.
| Compound Name | benzyl 3-hydroxy-2-[[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]benzoyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 66993266 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | benzyl 3-hydroxy-2-[[2-hydroxy-4-[2-(2-methoxyethoxy)ethoxy]benzoyl]amino]-2-methylpropanoate |
| SMILES | COCCOCCOc1ccc(C(=O)NC(C)(CO)C(=O)OCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C23H29NO8/c1-23(16-25,22(28)32-15-17-6-4-3-5-7-17)24-21(27)19-9-8-18(14-20(19)26)31-13-12-30-11-10-29-2/h3-9,14,25-26H,10-13,15-16H2,1-2H3,(H,24,27) |
| InChIKey | ZBDBDXRFNMUVQY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|