C24H26N2O4 — CID 165116977
benzyl (2S)-2-hydrazinyl-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoate (PubChem CID 165116977) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is benzyl (2S)-2-hydrazinyl-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoate.
| Compound Name | benzyl (2S)-2-hydrazinyl-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 165116977 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | benzyl (2S)-2-hydrazinyl-3-(4-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoate |
| SMILES | C[C@@](Cc1ccc(O)c(OCc2ccccc2)c1)(NN)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4/c1-24(26-25,23(28)30-17-19-10-6-3-7-11-19)15-20-12-13-21(27)22(14-20)29-16-18-8-4-2-5-9-18/h2-14,26-27H,15-17,25H2,1H3/t24-/m0/s1 |
| InChIKey | QVXVYGOIEZVIPO-DEOSSOPVSA-N |
| XLogP | 3.48 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|