C11H17N2O8P — CID 121282423
2-hydrazinyl-3-[4-hydroxy-3-(phosphonooxymethoxy)phenyl]-2-methylpropanoic acid (PubChem CID 121282423) has the molecular formula C11H17N2O8P and a molecular weight of 336.24 g/mol. Its IUPAC name is 2-hydrazinyl-3-[4-hydroxy-3-(phosphonooxymethoxy)phenyl]-2-methylpropanoic acid.
| Compound Name | 2-hydrazinyl-3-[4-hydroxy-3-(phosphonooxymethoxy)phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 121282423 |
| Molecular Formula | C11H17N2O8P |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-hydrazinyl-3-[4-hydroxy-3-(phosphonooxymethoxy)phenyl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(O)c(OCOP(=O)(O)O)c1)(NN)C(=O)O |
| InChI | InChI=1S/C11H17N2O8P/c1-11(13-12,10(15)16)5-7-2-3-8(14)9(4-7)20-6-21-22(17,18)19/h2-4,13-14H,5-6,12H2,1H3,(H,15,16)(H2,17,18,19) |
| InChIKey | XUCXGSFWCBCQGY-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 171.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|