C11H17NO5 — CID 23724778
3-(3,4-dihydroxyphenyl)-2-methyl-2-(methylamino)propanoic acid;hydrate (PubChem CID 23724778) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-methyl-2-(methylamino)propanoic acid;hydrate.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-methyl-2-(methylamino)propanoic acid;hydrate |
|---|---|
| PubChem CID | 23724778 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-methyl-2-(methylamino)propanoic acid;hydrate |
| SMILES | CNC(C)(Cc1ccc(O)c(O)c1)C(=O)O.O |
| InChI | InChI=1S/C11H15NO4.H2O/c1-11(12-2,10(15)16)6-7-3-4-8(13)9(14)5-7;/h3-5,12-14H,6H2,1-2H3,(H,15,16);1H2 |
| InChIKey | QVFXOHNUXDCSRP-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|