C14H27N5O4 — CID 174869413
N'-(2-aminoethyl)ethane-1,2-diamine;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (PubChem CID 174869413) has the molecular formula C14H27N5O4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N'-(2-aminoethyl)ethane-1,2-diamine;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid.
| Compound Name | N'-(2-aminoethyl)ethane-1,2-diamine;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 174869413 |
| Molecular Formula | C14H27N5O4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N'-(2-aminoethyl)ethane-1,2-diamine;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| SMILES | C[C@@](Cc1ccc(O)c(O)c1)(NN)C(=O)O.NCCNCCN |
| InChI | InChI=1S/C10H14N2O4.C4H13N3/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6;5-1-3-7-4-2-6/h2-4,12-14H,5,11H2,1H3,(H,15,16);7H,1-6H2/t10-;/m0./s1 |
| InChIKey | YEIMTVVFTSMYIX-PPHPATTJSA-N |
| XLogP | -1.56 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|