C13H20N2O6 — CID 22803212
(2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate (PubChem CID 22803212) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate.
| Compound Name | (2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate |
|---|---|
| PubChem CID | 22803212 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2S)-2-[[(2R)-2-aminopropanoyl]amino]-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrate |
| SMILES | C[C@@H](N)C(=O)N[C@@](C)(Cc1ccc(O)c(O)c1)C(=O)O.O |
| InChI | InChI=1S/C13H18N2O5.H2O/c1-7(14)11(18)15-13(2,12(19)20)6-8-3-4-9(16)10(17)5-8;/h3-5,7,16-17H,6,14H2,1-2H3,(H,15,18)(H,19,20);1H2/t7-,13+;/m1./s1 |
| InChIKey | DPMAWPLLTTZDAF-NZNXFSRSSA-N |
| XLogP | -0.88 |
| TPSA | 164.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|