C11H14O6 — CID 175403852
2-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydroxybutanoic acid (PubChem CID 175403852) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydroxybutanoic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 175403852 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydroxybutanoic acid |
| SMILES | CC(O)C(O)(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C11H14O6/c1-6(12)11(17,10(15)16)5-7-2-3-8(13)9(14)4-7/h2-4,6,12-14,17H,5H2,1H3,(H,15,16) |
| InChIKey | FWONAQOTRRGUIA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|