C22H22O11 — CID 162900529
(2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-3-[3-(3,4-dimethoxyphenyl)prop-2-enoyloxy]-2-hydroxybutanedioic acid (PubChem CID 162900529) has the molecular formula C22H22O11 and a molecular weight of 462.41 g/mol. Its IUPAC name is (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-3-[3-(3,4-dimethoxyphenyl)prop-2-enoyloxy]-2-hydroxybutanedioic acid.
| Compound Name | (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-3-[3-(3,4-dimethoxyphenyl)prop-2-enoyloxy]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 162900529 |
| Molecular Formula | C22H22O11 |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (2R,3S)-2-[(3,4-dihydroxyphenyl)methyl]-3-[3-(3,4-dimethoxyphenyl)prop-2-enoyloxy]-2-hydroxybutanedioic acid |
| SMILES | COc1ccc(C=CC(=O)O[C@H](C(=O)O)[C@](O)(Cc2ccc(O)c(O)c2)C(=O)O)cc1OC |
| InChI | InChI=1S/C22H22O11/c1-31-16-7-4-12(10-17(16)32-2)5-8-18(25)33-19(20(26)27)22(30,21(28)29)11-13-3-6-14(23)15(24)9-13/h3-10,19,23-24,30H,11H2,1-2H3,(H,26,27)(H,28,29)/t19-,22-/m1/s1 |
| InChIKey | YMPYAGUNPNITIL-DENIHFKCSA-N |
| XLogP | 1.18 |
| TPSA | 180.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|