C11H16N2O4 — CID 67576357
(3S)-4-(3,4-dihydroxyphenyl)-3-hydrazinyl-3-methylbutanoic acid (PubChem CID 67576357) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (3S)-4-(3,4-dihydroxyphenyl)-3-hydrazinyl-3-methylbutanoic acid.
| Compound Name | (3S)-4-(3,4-dihydroxyphenyl)-3-hydrazinyl-3-methylbutanoic acid |
|---|---|
| PubChem CID | 67576357 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (3S)-4-(3,4-dihydroxyphenyl)-3-hydrazinyl-3-methylbutanoic acid |
| SMILES | C[C@@](CC(=O)O)(Cc1ccc(O)c(O)c1)NN |
| InChI | InChI=1S/C11H16N2O4/c1-11(13-12,6-10(16)17)5-7-2-3-8(14)9(15)4-7/h2-4,13-15H,5-6,12H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | ZGEALPXLVBNKFN-NSHDSACASA-N |
| XLogP | 0.34 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|