C10H16N2O7P+ — CID 165103444
dihydroxy(oxo)phosphanium;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (PubChem CID 165103444) has the molecular formula C10H16N2O7P+ and a molecular weight of 307.22 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid.
| Compound Name | dihydroxy(oxo)phosphanium;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 165103444 |
| Molecular Formula | C10H16N2O7P+ |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | dihydroxy(oxo)phosphanium;(2S)-3-(3,4-dihydroxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| SMILES | C[C@@](Cc1ccc(O)c(O)c1)(NN)C(=O)O.O=[P+](O)O |
| InChI | InChI=1S/C10H14N2O4.HO3P/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6;1-4(2)3/h2-4,12-14H,5,11H2,1H3,(H,15,16);(H-,1,2,3)/p+1/t10-;/m0./s1 |
| InChIKey | HQSYNXLARKRGGO-PPHPATTJSA-O |
| XLogP | -0.42 |
| TPSA | 173.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|