C10H16N2O10P2 — CID 134365987
3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid (PubChem CID 134365987) has the molecular formula C10H16N2O10P2 and a molecular weight of 386.19 g/mol. Its IUPAC name is 3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid.
| Compound Name | 3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 134365987 |
| Molecular Formula | C10H16N2O10P2 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 3-(3,4-diphosphonooxyphenyl)-2-hydrazinyl-2-methylpropanoic acid |
| SMILES | CC(Cc1ccc(OP(=O)(O)O)c(OP(=O)(O)O)c1)(NN)C(=O)O |
| InChI | InChI=1S/C10H16N2O10P2/c1-10(12-11,9(13)14)5-6-2-3-7(21-23(15,16)17)8(4-6)22-24(18,19)20/h2-4,12H,5,11H2,1H3,(H,13,14)(H2,15,16,17)(H2,18,19,20) |
| InChIKey | LYLIRFRNFPSPFI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|