C11H17N2O6P — CID 121288702
[5-[(2S)-2-hydrazinyl-2-methyl-3-oxobutyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 121288702) has the molecular formula C11H17N2O6P and a molecular weight of 304.24 g/mol. Its IUPAC name is [5-[(2S)-2-hydrazinyl-2-methyl-3-oxobutyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [5-[(2S)-2-hydrazinyl-2-methyl-3-oxobutyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 121288702 |
| Molecular Formula | C11H17N2O6P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | [5-[(2S)-2-hydrazinyl-2-methyl-3-oxobutyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | CC(=O)[C@](C)(Cc1ccc(O)c(OP(=O)(O)O)c1)NN |
| InChI | InChI=1S/C11H17N2O6P/c1-7(14)11(2,13-12)6-8-3-4-9(15)10(5-8)19-20(16,17)18/h3-5,13,15H,6,12H2,1-2H3,(H2,16,17,18)/t11-/m0/s1 |
| InChIKey | SDDHTOUMIZBRNO-NSHDSACASA-N |
| XLogP | 0.22 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|