C21H25N2O10P — CID 67926056
ethyl (2S)-3-(4-hydroxy-3-phosphonooxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate (PubChem CID 67926056) has the molecular formula C21H25N2O10P and a molecular weight of 496.41 g/mol. Its IUPAC name is ethyl (2S)-3-(4-hydroxy-3-phosphonooxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-(4-hydroxy-3-phosphonooxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 67926056 |
| Molecular Formula | C21H25N2O10P |
| Molecular Weight | 496.41 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | ethyl (2S)-3-(4-hydroxy-3-phosphonooxyphenyl)-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)c(OP(=O)(O)O)c1)NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H25N2O10P/c1-2-31-20(26)16(10-15-8-9-17(24)18(11-15)33-34(28,29)30)23-19(25)12-22-21(27)32-13-14-6-4-3-5-7-14/h3-9,11,16,24H,2,10,12-13H2,1H3,(H,22,27)(H,23,25)(H2,28,29,30)/t16-/m0/s1 |
| InChIKey | VRFKIRAUZACBQY-INIZCTEOSA-N |
| XLogP | 1.38 |
| TPSA | 180.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|