C9H14N3O7P — CID 146617236
(2S)-2-amino-2-hydrazinyl-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid (PubChem CID 146617236) has the molecular formula C9H14N3O7P and a molecular weight of 307.20 g/mol. Its IUPAC name is (2S)-2-amino-2-hydrazinyl-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid.
| Compound Name | (2S)-2-amino-2-hydrazinyl-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 146617236 |
| Molecular Formula | C9H14N3O7P |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (2S)-2-amino-2-hydrazinyl-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid |
| SMILES | NN[C@@](N)(Cc1ccc(OP(=O)(O)O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C9H14N3O7P/c10-9(12-11,8(14)15)4-5-1-2-7(6(13)3-5)19-20(16,17)18/h1-3,12-13H,4,10-11H2,(H,14,15)(H2,16,17,18)/t9-/m0/s1 |
| InChIKey | HGSORQOFELCQFW-VIFPVBQESA-N |
| XLogP | -1.39 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|