C17H21N2O7P — CID 156647221
[4-[2-amino-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 156647221) has the molecular formula C17H21N2O7P and a molecular weight of 396.34 g/mol. Its IUPAC name is [4-[2-amino-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [4-[2-amino-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 156647221 |
| Molecular Formula | C17H21N2O7P |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [4-[2-amino-3-[2-(4-hydroxyphenyl)ethylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | NC(Cc1ccc(OP(=O)(O)O)c(O)c1)C(=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C17H21N2O7P/c18-14(17(22)19-8-7-11-1-4-13(20)5-2-11)9-12-3-6-16(15(21)10-12)26-27(23,24)25/h1-6,10,14,20-21H,7-9,18H2,(H,19,22)(H2,23,24,25) |
| InChIKey | ITUBJXNPRLFUDQ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|