C14H24N5O6P — CID 156647207
[4-[2-amino-3-[4-(diaminomethylideneamino)butylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate (PubChem CID 156647207) has the molecular formula C14H24N5O6P and a molecular weight of 389.35 g/mol. Its IUPAC name is [4-[2-amino-3-[4-(diaminomethylideneamino)butylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate.
| Compound Name | [4-[2-amino-3-[4-(diaminomethylideneamino)butylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 156647207 |
| Molecular Formula | C14H24N5O6P |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | [4-[2-amino-3-[4-(diaminomethylideneamino)butylamino]-3-oxopropyl]-2-hydroxyphenyl] dihydrogen phosphate |
| SMILES | NC(N)=NCCCCNC(=O)C(N)Cc1ccc(OP(=O)(O)O)c(O)c1 |
| InChI | InChI=1S/C14H24N5O6P/c15-10(13(21)18-5-1-2-6-19-14(16)17)7-9-3-4-12(11(20)8-9)25-26(22,23)24/h3-4,8,10,20H,1-2,5-7,15H2,(H,18,21)(H4,16,17,19)(H2,22,23,24) |
| InChIKey | ZEHXZVUGOOUMSN-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 206.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|