C12H18N3O8P — CID 165116850
2-[2-(3-aminopropanoyl)hydrazinyl]-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid (PubChem CID 165116850) has the molecular formula C12H18N3O8P and a molecular weight of 363.26 g/mol. Its IUPAC name is 2-[2-(3-aminopropanoyl)hydrazinyl]-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid.
| Compound Name | 2-[2-(3-aminopropanoyl)hydrazinyl]-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 165116850 |
| Molecular Formula | C12H18N3O8P |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[2-(3-aminopropanoyl)hydrazinyl]-3-(3-hydroxy-4-phosphonooxyphenyl)propanoic acid |
| SMILES | NCCC(=O)NNC(Cc1ccc(OP(=O)(O)O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C12H18N3O8P/c13-4-3-11(17)15-14-8(12(18)19)5-7-1-2-10(9(16)6-7)23-24(20,21)22/h1-2,6,8,14,16H,3-5,13H2,(H,15,17)(H,18,19)(H2,20,21,22) |
| InChIKey | GUUFAGPAZGOGPG-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|