C14H18NO10P — CID 165117025
5-[[(1S)-1-carboxy-2-(3-hydroxy-4-phosphonooxyphenyl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 165117025) has the molecular formula C14H18NO10P and a molecular weight of 391.27 g/mol. Its IUPAC name is 5-[[(1S)-1-carboxy-2-(3-hydroxy-4-phosphonooxyphenyl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(1S)-1-carboxy-2-(3-hydroxy-4-phosphonooxyphenyl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 165117025 |
| Molecular Formula | C14H18NO10P |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 5-[[(1S)-1-carboxy-2-(3-hydroxy-4-phosphonooxyphenyl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C14H18NO10P/c16-10-7-8(4-5-11(10)25-26(22,23)24)6-9(14(20)21)15-12(17)2-1-3-13(18)19/h4-5,7,9,16H,1-3,6H2,(H,15,17)(H,18,19)(H,20,21)(H2,22,23,24)/t9-/m0/s1 |
| InChIKey | GVRYWCICASMXLU-VIFPVBQESA-N |
| XLogP | 0.23 |
| TPSA | 190.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|