C29H41NO5 — CID 171116777
(2S)-3-(3,4-dihydroxyphenyl)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]propanoic acid (PubChem CID 171116777) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is (2S)-3-(3,4-dihydroxyphenyl)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]propanoic acid.
| Compound Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 171116777 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | (2S)-3-(3,4-dihydroxyphenyl)-2-[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]amino]propanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C29H41NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-28(33)30-25(29(34)35)22-24-20-21-26(31)27(32)23-24/h6-7,9-10,12-13,15-16,20-21,23,25,31-32H,2-5,8,11,14,17-19,22H2,1H3,(H,30,33)(H,34,35)/b7-6-,10-9-,13-12-,16-15-/t25-/m0/s1 |
| InChIKey | ROVSXTPPCHDOJN-IELUMNCWSA-N |
| XLogP | 6.36 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|