C25H39NO5 — CID 164519597
(2S)-2-(icosa-5,8,11,14-tetraenoylamino)pentanedioic acid (PubChem CID 164519597) has the molecular formula C25H39NO5 and a molecular weight of 433.59 g/mol. Its IUPAC name is (2S)-2-(icosa-5,8,11,14-tetraenoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(icosa-5,8,11,14-tetraenoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 164519597 |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (2S)-2-(icosa-5,8,11,14-tetraenoylamino)pentanedioic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H39NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(27)26-22(25(30)31)20-21-24(28)29/h6-7,9-10,12-13,15-16,22H,2-5,8,11,14,17-21H2,1H3,(H,26,27)(H,28,29)(H,30,31)/t22-/m0/s1 |
| InChIKey | IQKGZNHDNWUCTC-QFIPXVFZSA-N |
| XLogP | 5.57 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|