C25H44N2O4 — CID 154049490
5-(ethylamino)-2-(octadeca-9,12-dienoylamino)-5-oxopentanoic acid (PubChem CID 154049490) has the molecular formula C25H44N2O4 and a molecular weight of 436.64 g/mol. Its IUPAC name is 5-(ethylamino)-2-(octadeca-9,12-dienoylamino)-5-oxopentanoic acid.
| Compound Name | 5-(ethylamino)-2-(octadeca-9,12-dienoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 154049490 |
| Molecular Formula | C25H44N2O4 |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | 5-(ethylamino)-2-(octadeca-9,12-dienoylamino)-5-oxopentanoic acid |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)NC(CCC(=O)NCC)C(=O)O |
| InChI | InChI=1S/C25H44N2O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(29)27-22(25(30)31)20-21-23(28)26-4-2/h8-9,11-12,22H,3-7,10,13-21H2,1-2H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | BRONCQRHDCEGGQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|