C31H43NO4 — CID 126678460
(5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-(3,4-dihydroxyphenyl)-3-methoxybut-3-en-2-yl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 126678460) has the molecular formula C31H43NO4 and a molecular weight of 493.69 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-(3,4-dihydroxyphenyl)-3-methoxybut-3-en-2-yl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-(3,4-dihydroxyphenyl)-3-methoxybut-3-en-2-yl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 126678460 |
| Molecular Formula | C31H43NO4 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | (5Z,8Z,11Z,14Z,17Z)-N-[(2S)-1-(3,4-dihydroxyphenyl)-3-methoxybut-3-en-2-yl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | C=C(OC)[C@H](Cc1ccc(O)c(O)c1)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC |
| InChI | InChI=1S/C31H43NO4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-31(35)32-28(26(2)36-3)24-27-22-23-29(33)30(34)25-27/h5-6,8-9,11-12,14-15,17-18,22-23,25,28,33-34H,2,4,7,10,13,16,19-21,24H2,1,3H3,(H,32,35)/b6-5-,9-8-,12-11-,15-14-,18-17-/t28-/m0/s1 |
| InChIKey | YIPGAIXFWINIPA-CPEJGQHDSA-N |
| XLogP | 7.21 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|